C19H23ClN2 — CID 23223752
3-[2-(3-chlorophenyl)ethyl]-2-(1-methylpiperidin-2-yl)pyridine (PubChem CID 23223752) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethyl]-2-(1-methylpiperidin-2-yl)pyridine.
| Compound Name | 3-[2-(3-chlorophenyl)ethyl]-2-(1-methylpiperidin-2-yl)pyridine |
|---|---|
| PubChem CID | 23223752 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethyl]-2-(1-methylpiperidin-2-yl)pyridine |
| SMILES | CN1CCCCC1c1ncccc1CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2/c1-22-13-3-2-9-18(22)19-16(7-5-12-21-19)11-10-15-6-4-8-17(20)14-15/h4-8,12,14,18H,2-3,9-11,13H2,1H3 |
| InChIKey | YLQXBFKOTMYKLC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |