C7H16Cl3N2OP — CID 2322763
N-[dimethylamino(trichloromethyl)phosphoryl]-2-methylpropan-2-amine (PubChem CID 2322763) has the molecular formula C7H16Cl3N2OP and a molecular weight of 281.55 g/mol. Its IUPAC name is N-[dimethylamino(trichloromethyl)phosphoryl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethylamino(trichloromethyl)phosphoryl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 2322763 |
| Molecular Formula | C7H16Cl3N2OP |
| Molecular Weight | 281.55 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | N-[dimethylamino(trichloromethyl)phosphoryl]-2-methylpropan-2-amine |
| SMILES | CN(C)P(=O)(NC(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H16Cl3N2OP/c1-6(2,3)11-14(13,12(4)5)7(8,9)10/h1-5H3,(H,11,13) |
| InChIKey | DNORIAUHIUOGHH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|