C23H28O7 — CID 23229749
(1S,3R,4R,5S,6R,7R)-6-methoxy-3,4-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octane-4,7-diol (PubChem CID 23229749) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (1S,3R,4R,5S,6R,7R)-6-methoxy-3,4-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octane-4,7-diol.
| Compound Name | (1S,3R,4R,5S,6R,7R)-6-methoxy-3,4-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octane-4,7-diol |
|---|---|
| PubChem CID | 23229749 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (1S,3R,4R,5S,6R,7R)-6-methoxy-3,4-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octane-4,7-diol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H]2O[C@H](COCc3ccccc3)[C@](O)(COCc3ccccc3)[C@H]1O2 |
| InChI | InChI=1S/C23H28O7/c1-26-20-19(24)22-29-18(14-27-12-16-8-4-2-5-9-16)23(25,21(20)30-22)15-28-13-17-10-6-3-7-11-17/h2-11,18-22,24-25H,12-15H2,1H3/t18-,19-,20-,21+,22+,23-/m1/s1 |
| InChIKey | LYBVMUJORBQLQZ-LAAXVVMPSA-N |
| XLogP | 1.65 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |