C7H11FO3 — CID 23235441
methyl (2S,3R)-2-fluoro-3-propyloxirane-2-carboxylate (PubChem CID 23235441) has the molecular formula C7H11FO3 and a molecular weight of 162.16 g/mol. Its IUPAC name is methyl (2S,3R)-2-fluoro-3-propyloxirane-2-carboxylate.
| Compound Name | methyl (2S,3R)-2-fluoro-3-propyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 23235441 |
| Molecular Formula | C7H11FO3 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | methyl (2S,3R)-2-fluoro-3-propyloxirane-2-carboxylate |
| SMILES | CCC[C@H]1O[C@@]1(F)C(=O)OC |
| InChI | InChI=1S/C7H11FO3/c1-3-4-5-7(8,11-5)6(9)10-2/h5H,3-4H2,1-2H3/t5-,7-/m1/s1 |
| InChIKey | NAPQVNHDMHUVLW-IYSWYEEDSA-N |
| XLogP | 1.02 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|