C7H11ClO3 — CID 11423916
methyl (2S,3R)-2-chloro-3-propyloxirane-2-carboxylate (PubChem CID 11423916) has the molecular formula C7H11ClO3 and a molecular weight of 178.61 g/mol. Its IUPAC name is methyl (2S,3R)-2-chloro-3-propyloxirane-2-carboxylate.
| Compound Name | methyl (2S,3R)-2-chloro-3-propyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 11423916 |
| Molecular Formula | C7H11ClO3 |
| Molecular Weight | 178.61 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | methyl (2S,3R)-2-chloro-3-propyloxirane-2-carboxylate |
| SMILES | CCC[C@H]1O[C@@]1(Cl)C(=O)OC |
| InChI | InChI=1S/C7H11ClO3/c1-3-4-5-7(8,11-5)6(9)10-2/h5H,3-4H2,1-2H3/t5-,7-/m1/s1 |
| InChIKey | ATBCQIQSXKNXTR-IYSWYEEDSA-N |
| XLogP | 1.29 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.61 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|