C12H15ClF2O7 — CID 23236817
[(3R,4R,5R,6R)-4,6-diacetyloxy-5-[chloro(difluoro)methyl]oxan-3-yl] acetate (PubChem CID 23236817) has the molecular formula C12H15ClF2O7 and a molecular weight of 344.69 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,6-diacetyloxy-5-[chloro(difluoro)methyl]oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-4,6-diacetyloxy-5-[chloro(difluoro)methyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 23236817 |
| Molecular Formula | C12H15ClF2O7 |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [(3R,4R,5R,6R)-4,6-diacetyloxy-5-[chloro(difluoro)methyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1C(F)(F)Cl |
| InChI | InChI=1S/C12H15ClF2O7/c1-5(16)20-8-4-19-11(22-7(3)18)9(12(13,14)15)10(8)21-6(2)17/h8-11H,4H2,1-3H3/t8-,9-,10+,11-/m1/s1 |
| InChIKey | PWNXZJUVFIRAPL-CHWFTXMASA-N |
| XLogP | 1.22 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|