C9H3F15OS — CID 23236913
S-methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanethioate (PubChem CID 23236913) has the molecular formula C9H3F15OS and a molecular weight of 444.16 g/mol. Its IUPAC name is S-methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanethioate.
| Compound Name | S-methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanethioate |
|---|---|
| PubChem CID | 23236913 |
| Molecular Formula | C9H3F15OS |
| Molecular Weight | 444.16 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | S-methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanethioate |
| SMILES | CSC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H3F15OS/c1-26-2(25)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24/h1H3 |
| InChIKey | IIJSUCZRKPSLNN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.16 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|