C13H9F13OS — CID 23237074
(1S,4S,5R)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 23237074) has the molecular formula C13H9F13OS and a molecular weight of 460.26 g/mol. Its IUPAC name is (1S,4S,5R)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5R)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 23237074 |
| Molecular Formula | C13H9F13OS |
| Molecular Weight | 460.26 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | (1S,4S,5R)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | O=S([C@@H]1C[C@H]2C=C[C@@H]1C2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F13OS/c14-8(15,10(18,19)12(22,23)24)9(16,17)11(20,21)13(25,26)28(27)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2/t5-,6+,7+,28?/m0/s1 |
| InChIKey | SFIGAKQSMRNRCE-APKSMOALSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|