C11H15F3O2S — CID 24785401
5-butylsulfonyl-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene (PubChem CID 24785401) has the molecular formula C11H15F3O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is 5-butylsulfonyl-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-butylsulfonyl-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 24785401 |
| Molecular Formula | C11H15F3O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5-butylsulfonyl-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene |
| SMILES | CCCCS(=O)(=O)C1(F)C2C=CC(C2)C1(F)F |
| InChI | InChI=1S/C11H15F3O2S/c1-2-3-6-17(15,16)11(14)9-5-4-8(7-9)10(11,12)13/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | WLQUCJNPARHYFZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|