C8H9F3O2S — CID 24785400
5,5,6-trifluoro-6-methylsulfonylbicyclo[2.2.1]hept-2-ene (PubChem CID 24785400) has the molecular formula C8H9F3O2S and a molecular weight of 226.22 g/mol. Its IUPAC name is 5,5,6-trifluoro-6-methylsulfonylbicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,5,6-trifluoro-6-methylsulfonylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 24785400 |
| Molecular Formula | C8H9F3O2S |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 5,5,6-trifluoro-6-methylsulfonylbicyclo[2.2.1]hept-2-ene |
| SMILES | CS(=O)(=O)C1(F)C2C=CC(C2)C1(F)F |
| InChI | InChI=1S/C8H9F3O2S/c1-14(12,13)8(11)6-3-2-5(4-6)7(8,9)10/h2-3,5-6H,4H2,1H3 |
| InChIKey | BMABHYCVNRTYPY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|