C19H17N3O8S — CID 23238804
methyl 2-[(4-methylphenyl)sulfonyl-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]amino]acetate (PubChem CID 23238804) has the molecular formula C19H17N3O8S and a molecular weight of 447.43 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)sulfonyl-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]amino]acetate.
| Compound Name | methyl 2-[(4-methylphenyl)sulfonyl-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]amino]acetate |
|---|---|
| PubChem CID | 23238804 |
| Molecular Formula | C19H17N3O8S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | methyl 2-[(4-methylphenyl)sulfonyl-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]amino]acetate |
| SMILES | COC(=O)CN(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H17N3O8S/c1-12-3-6-14(7-4-12)31(28,29)20(10-17(23)30-2)11-21-18(24)15-8-5-13(22(26)27)9-16(15)19(21)25/h3-9H,10-11H2,1-2H3 |
| InChIKey | VHWVXDYUOQKHQY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 144.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|