C15H10N2O7S — CID 18737688
(5-nitro-1,3-dioxoisoindol-2-yl)oxy 4-methylbenzenesulfinate (PubChem CID 18737688) has the molecular formula C15H10N2O7S and a molecular weight of 362.32 g/mol. Its IUPAC name is (5-nitro-1,3-dioxoisoindol-2-yl)oxy 4-methylbenzenesulfinate.
| Compound Name | (5-nitro-1,3-dioxoisoindol-2-yl)oxy 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 18737688 |
| Molecular Formula | C15H10N2O7S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (5-nitro-1,3-dioxoisoindol-2-yl)oxy 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)OON2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C15H10N2O7S/c1-9-2-5-11(6-3-9)25(22)24-23-16-14(18)12-7-4-10(17(20)21)8-13(12)15(16)19/h2-8H,1H3 |
| InChIKey | KNZMCNVCUNIWBJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|