C21H34BrNO5S — CID 23240633
N-[(E,3S,6S)-4-bromo-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 23240633) has the molecular formula C21H34BrNO5S and a molecular weight of 492.48 g/mol. Its IUPAC name is N-[(E,3S,6S)-4-bromo-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(E,3S,6S)-4-bromo-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23240633 |
| Molecular Formula | C21H34BrNO5S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[(E,3S,6S)-4-bromo-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | COCCOCO[C@@H](C)/C=C(/Br)[C@@H](NS(=O)(=O)c1c(C)cc(C)cc1C)C(C)C |
| InChI | InChI=1S/C21H34BrNO5S/c1-14(2)20(19(22)12-18(6)28-13-27-9-8-26-7)23-29(24,25)21-16(4)10-15(3)11-17(21)5/h10-12,14,18,20,23H,8-9,13H2,1-7H3/b19-12+/t18-,20-/m0/s1 |
| InChIKey | ZAQSTTXXOMKLNL-NXNHRUAKSA-N |
| XLogP | 4.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|