C21H35NO5S — CID 23240652
N-[(Z,3S,6S)-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 23240652) has the molecular formula C21H35NO5S and a molecular weight of 413.58 g/mol. Its IUPAC name is N-[(Z,3S,6S)-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(Z,3S,6S)-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23240652 |
| Molecular Formula | C21H35NO5S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[(Z,3S,6S)-6-(2-methoxyethoxymethoxy)-2-methylhept-4-en-3-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | COCCOCO[C@@H](C)/C=C\[C@@H](NS(=O)(=O)c1c(C)cc(C)cc1C)C(C)C |
| InChI | InChI=1S/C21H35NO5S/c1-15(2)20(9-8-19(6)27-14-26-11-10-25-7)22-28(23,24)21-17(4)12-16(3)13-18(21)5/h8-9,12-13,15,19-20,22H,10-11,14H2,1-7H3/b9-8-/t19-,20+/m0/s1 |
| InChIKey | IJTPCOMWKMMWAV-MITRTKIPSA-N |
| XLogP | 3.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|