C15H26O6 — CID 23243019
(2R)-2-[[(3R,5R,6R)-5-ethyl-6-(2-methoxy-2-oxoethyl)-3-methyldioxan-3-yl]methyl]butanoic acid (PubChem CID 23243019) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2R)-2-[[(3R,5R,6R)-5-ethyl-6-(2-methoxy-2-oxoethyl)-3-methyldioxan-3-yl]methyl]butanoic acid.
| Compound Name | (2R)-2-[[(3R,5R,6R)-5-ethyl-6-(2-methoxy-2-oxoethyl)-3-methyldioxan-3-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 23243019 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2R)-2-[[(3R,5R,6R)-5-ethyl-6-(2-methoxy-2-oxoethyl)-3-methyldioxan-3-yl]methyl]butanoic acid |
| SMILES | CC[C@H](C[C@@]1(C)C[C@@H](CC)[C@@H](CC(=O)OC)OO1)C(=O)O |
| InChI | InChI=1S/C15H26O6/c1-5-10-8-15(3,9-11(6-2)14(17)18)21-20-12(10)7-13(16)19-4/h10-12H,5-9H2,1-4H3,(H,17,18)/t10-,11-,12-,15-/m1/s1 |
| InChIKey | UUYHUSNRSRTJNQ-RTWAVKEYSA-N |
| XLogP | 2.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|