C25H42OSi — CID 23243429
tert-butyl-dimethyl-[[2,2,4-trimethyl-3-[(E)-2-(1-methylcyclohexa-2,5-dien-1-yl)ethenyl]cyclohex-3-en-1-yl]methoxy]silane (PubChem CID 23243429) has the molecular formula C25H42OSi and a molecular weight of 386.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[2,2,4-trimethyl-3-[(E)-2-(1-methylcyclohexa-2,5-dien-1-yl)ethenyl]cyclohex-3-en-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[2,2,4-trimethyl-3-[(E)-2-(1-methylcyclohexa-2,5-dien-1-yl)ethenyl]cyclohex-3-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 23243429 |
| Molecular Formula | C25H42OSi |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | tert-butyl-dimethyl-[[2,2,4-trimethyl-3-[(E)-2-(1-methylcyclohexa-2,5-dien-1-yl)ethenyl]cyclohex-3-en-1-yl]methoxy]silane |
| SMILES | CC1=C(/C=C/C2(C)C=CCC=C2)C(C)(C)C(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H42OSi/c1-20-13-14-21(19-26-27(8,9)23(2,3)4)24(5,6)22(20)15-18-25(7)16-11-10-12-17-25/h11-12,15-18,21H,10,13-14,19H2,1-9H3/b18-15+ |
| InChIKey | PMIVBFLSRICLEP-OBGWFSINSA-N |
| XLogP | 7.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|