C17H33ClOSi — CID 23243437
[(3R,4S)-4-(6-chlorohexyl)-3-propan-2-ylcyclopenten-1-yl]oxy-trimethylsilane (PubChem CID 23243437) has the molecular formula C17H33ClOSi and a molecular weight of 316.99 g/mol. Its IUPAC name is [(3R,4S)-4-(6-chlorohexyl)-3-propan-2-ylcyclopenten-1-yl]oxy-trimethylsilane.
| Compound Name | [(3R,4S)-4-(6-chlorohexyl)-3-propan-2-ylcyclopenten-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 23243437 |
| Molecular Formula | C17H33ClOSi |
| Molecular Weight | 316.99 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [(3R,4S)-4-(6-chlorohexyl)-3-propan-2-ylcyclopenten-1-yl]oxy-trimethylsilane |
| SMILES | CC(C)[C@H]1C=C(O[Si](C)(C)C)C[C@@H]1CCCCCCCl |
| InChI | InChI=1S/C17H33ClOSi/c1-14(2)17-13-16(19-20(3,4)5)12-15(17)10-8-6-7-9-11-18/h13-15,17H,6-12H2,1-5H3/t15-,17+/m0/s1 |
| InChIKey | SPSBNZKLJJVKHB-DOTOQJQBSA-N |
| XLogP | 6.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.99 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|