C18H28Cl2HgO2 — CID 10768973
chloro-[4-[(1S,2R,3S)-3-(6-chlorohexyl)-5-oxo-2-propan-2-ylcyclopentyl]-3-oxobut-1-en-2-yl]mercury (PubChem CID 10768973) has the molecular formula C18H28Cl2HgO2 and a molecular weight of 547.92 g/mol. Its IUPAC name is chloro-[4-[(1S,2R,3S)-3-(6-chlorohexyl)-5-oxo-2-propan-2-ylcyclopentyl]-3-oxobut-1-en-2-yl]mercury.
| Compound Name | chloro-[4-[(1S,2R,3S)-3-(6-chlorohexyl)-5-oxo-2-propan-2-ylcyclopentyl]-3-oxobut-1-en-2-yl]mercury |
|---|---|
| PubChem CID | 10768973 |
| Molecular Formula | C18H28Cl2HgO2 |
| Molecular Weight | 547.92 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | chloro-[4-[(1S,2R,3S)-3-(6-chlorohexyl)-5-oxo-2-propan-2-ylcyclopentyl]-3-oxobut-1-en-2-yl]mercury |
| SMILES | C=C([Hg]Cl)C(=O)C[C@@H]1C(=O)C[C@H](CCCCCCCl)[C@H]1C(C)C |
| InChI | InChI=1S/C18H28ClO2.ClH.Hg/c1-4-15(20)12-16-17(21)11-14(18(16)13(2)3)9-7-5-6-8-10-19;;/h13-14,16,18H,1,5-12H2,2-3H3;1H;/q;;+1/p-1/t14-,16+,18+;;/m0../s1 |
| InChIKey | FFBSLMLPECKGOX-KYWSACDSSA-M |
| XLogP | 5.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.92 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|