C22H23F3O3S — CID 23243906
[(2S,3R)-1,1,1-trifluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-yl] benzoate (PubChem CID 23243906) has the molecular formula C22H23F3O3S and a molecular weight of 424.48 g/mol. Its IUPAC name is [(2S,3R)-1,1,1-trifluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-yl] benzoate.
| Compound Name | [(2S,3R)-1,1,1-trifluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-yl] benzoate |
|---|---|
| PubChem CID | 23243906 |
| Molecular Formula | C22H23F3O3S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [(2S,3R)-1,1,1-trifluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-yl] benzoate |
| SMILES | CC(C)=CC[C@H]([C@@H](OC(=O)c1ccccc1)C(F)(F)F)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23F3O3S/c1-15(2)9-14-19(29(27)18-12-10-16(3)11-13-18)20(22(23,24)25)28-21(26)17-7-5-4-6-8-17/h4-13,19-20H,14H2,1-3H3/t19-,20-,29?/m1/s1 |
| InChIKey | CRMCUHFZSLFOJP-MZLOAMTASA-N |
| XLogP | 5.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|