C17H21ClN4O4 — CID 23244897
(1S,6R,10R,11R)-10-[(6-chloropurin-9-yl)methyl]-3,3,11-trimethyl-2,4,7-trioxatricyclo[4.3.2.01,5]undecan-11-ol (PubChem CID 23244897) has the molecular formula C17H21ClN4O4 and a molecular weight of 380.83 g/mol. Its IUPAC name is (1S,6R,10R,11R)-10-[(6-chloropurin-9-yl)methyl]-3,3,11-trimethyl-2,4,7-trioxatricyclo[4.3.2.01,5]undecan-11-ol.
| Compound Name | (1S,6R,10R,11R)-10-[(6-chloropurin-9-yl)methyl]-3,3,11-trimethyl-2,4,7-trioxatricyclo[4.3.2.01,5]undecan-11-ol |
|---|---|
| PubChem CID | 23244897 |
| Molecular Formula | C17H21ClN4O4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (1S,6R,10R,11R)-10-[(6-chloropurin-9-yl)methyl]-3,3,11-trimethyl-2,4,7-trioxatricyclo[4.3.2.01,5]undecan-11-ol |
| SMILES | CC1(C)OC2[C@H]3OCC[C@]2(O1)[C@H](Cn1cnc2c(Cl)ncnc21)[C@@]3(C)O |
| InChI | InChI=1S/C17H21ClN4O4/c1-15(2)25-12-11-16(3,23)9(17(12,26-15)4-5-24-11)6-22-8-21-10-13(18)19-7-20-14(10)22/h7-9,11-12,23H,4-6H2,1-3H3/t9-,11-,12?,16-,17+/m1/s1 |
| InChIKey | SXNYEYKSMZEFLT-MHNKLHPVSA-N |
| XLogP | 1.54 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |