About 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine
6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine (PubChem CID 87770231) has the molecular formula C15H17ClN4
and a molecular weight of 288.78 g/mol. Its IUPAC name is 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine.
Molecular Properties
| Compound Name | 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine |
| PubChem CID | 87770231 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine |
| SMILES | CC1(C)[C@H]2CC=C(Cn3cnc4c(Cl)ncnc43)[C@H]1C2 |
| InChI | InChI=1S/C15H17ClN4/c1-15(2)10-4-3-9(11(15)5-10)6-20-8-19-12-13(16)17-7-18-14(12)20/h3,7-8,10-11H,4-6H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | YROJDNYMZYVKSA-WDEREUQCSA-N |
| XLogP | 3.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine?
The IUPAC name of 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine (CID 87770231) is 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine.
What is the SMILES notation for 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine?
The canonical SMILES for 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine is CC1(C)[C@H]2CC=C(Cn3cnc4c(Cl)ncnc43)[C@H]1C2.
What is the InChIKey of 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine?
The InChIKey is YROJDNYMZYVKSA-WDEREUQCSA-N. The full InChI is InChI=1S/C15H17ClN4/c1-15(2)10-4-3-9(11(15)5-10)6-20-8-19-12-13(16)17-7-18-14(12)20/h3,7-8,10-11H,4-6H2,1-2H3/t10-,11+/m0/s1.
What are the key properties of 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine?
6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine has a molecular weight of 288.78 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-9-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]purine is sourced from PubChem (CID 87770231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).