C15H13N5O6 — CID 23246538
N'-(2,4-dinitrophenyl)-2-oxo-4-pyridin-3-ylbutanehydrazide (PubChem CID 23246538) has the molecular formula C15H13N5O6 and a molecular weight of 359.30 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-2-oxo-4-pyridin-3-ylbutanehydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-2-oxo-4-pyridin-3-ylbutanehydrazide |
|---|---|
| PubChem CID | 23246538 |
| Molecular Formula | C15H13N5O6 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-2-oxo-4-pyridin-3-ylbutanehydrazide |
| SMILES | O=C(CCc1cccnc1)C(=O)NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N5O6/c21-14(6-3-10-2-1-7-16-9-10)15(22)18-17-12-5-4-11(19(23)24)8-13(12)20(25)26/h1-2,4-5,7-9,17H,3,6H2,(H,18,22) |
| InChIKey | QRGMUPMHIDTZGF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|