About 4-bromo-N,N-di(propan-2-yl)butanamide
4-bromo-N,N-di(propan-2-yl)butanamide (PubChem CID 23249395) has the molecular formula C10H20BrNO
and a molecular weight of 250.18 g/mol. Its IUPAC name is 4-bromo-N,N-di(propan-2-yl)butanamide.
Molecular Properties
| Compound Name | 4-bromo-N,N-di(propan-2-yl)butanamide |
| PubChem CID | 23249395 |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-bromo-N,N-di(propan-2-yl)butanamide |
| SMILES | CC(C)N(C(=O)CCCBr)C(C)C |
| InChI | InChI=1S/C10H20BrNO/c1-8(2)12(9(3)4)10(13)6-5-7-11/h8-9H,5-7H2,1-4H3 |
| InChIKey | VFMQHMYCAMWKIB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N,N-di(propan-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-di(propan-2-yl)butanamide?
The IUPAC name of 4-bromo-N,N-di(propan-2-yl)butanamide (CID 23249395) is 4-bromo-N,N-di(propan-2-yl)butanamide.
What is the SMILES notation for 4-bromo-N,N-di(propan-2-yl)butanamide?
The canonical SMILES for 4-bromo-N,N-di(propan-2-yl)butanamide is CC(C)N(C(=O)CCCBr)C(C)C.
What is the InChIKey of 4-bromo-N,N-di(propan-2-yl)butanamide?
The InChIKey is VFMQHMYCAMWKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrNO/c1-8(2)12(9(3)4)10(13)6-5-7-11/h8-9H,5-7H2,1-4H3.
What are the key properties of 4-bromo-N,N-di(propan-2-yl)butanamide?
4-bromo-N,N-di(propan-2-yl)butanamide has a molecular weight of 250.18 g/mol, XLogP of 2.81, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-di(propan-2-yl)butanamide is sourced from PubChem (CID 23249395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).