C16H10N4O2 — CID 23249560
2-(4-nitrophenyl)-[1,2,4]triazolo[5,1-a]isoquinoline (PubChem CID 23249560) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-[1,2,4]triazolo[5,1-a]isoquinoline.
| Compound Name | 2-(4-nitrophenyl)-[1,2,4]triazolo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 23249560 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-(4-nitrophenyl)-[1,2,4]triazolo[5,1-a]isoquinoline |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3c4ccccc4ccn3n2)cc1 |
| InChI | InChI=1S/C16H10N4O2/c21-20(22)13-7-5-12(6-8-13)15-17-16-14-4-2-1-3-11(14)9-10-19(16)18-15/h1-10H |
| InChIKey | WKELRLXNECITNF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|