C33H34N2O8 — CID 23250949
ethyl 3-(3,4-dimethoxyphenyl)-2-[[3-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]ethyl]-1H-indol-5-yl]oxy]-3-oxopropanoate (PubChem CID 23250949) has the molecular formula C33H34N2O8 and a molecular weight of 586.64 g/mol. Its IUPAC name is ethyl 3-(3,4-dimethoxyphenyl)-2-[[3-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]ethyl]-1H-indol-5-yl]oxy]-3-oxopropanoate.
| Compound Name | ethyl 3-(3,4-dimethoxyphenyl)-2-[[3-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]ethyl]-1H-indol-5-yl]oxy]-3-oxopropanoate |
|---|---|
| PubChem CID | 23250949 |
| Molecular Formula | C33H34N2O8 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | ethyl 3-(3,4-dimethoxyphenyl)-2-[[3-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]ethyl]-1H-indol-5-yl]oxy]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Oc1ccc2[nH]cc(CCNC(=O)/C=C/c3ccc(OC)cc3)c2c1)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H34N2O8/c1-5-42-33(38)32(31(37)22-9-14-28(40-3)29(18-22)41-4)43-25-12-13-27-26(19-25)23(20-35-27)16-17-34-30(36)15-8-21-6-10-24(39-2)11-7-21/h6-15,18-20,32,35H,5,16-17H2,1-4H3,(H,34,36)/b15-8+ |
| InChIKey | WPKFJIMMQHOVBA-OVCLIPMQSA-N |
| XLogP | 4.76 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|