C10H16O3 — CID 23255642
(4S,5S)-4-[(1R)-1-hydroxyethyl]-3-methylidene-5-propan-2-yloxolan-2-one (PubChem CID 23255642) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (4S,5S)-4-[(1R)-1-hydroxyethyl]-3-methylidene-5-propan-2-yloxolan-2-one.
| Compound Name | (4S,5S)-4-[(1R)-1-hydroxyethyl]-3-methylidene-5-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 23255642 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (4S,5S)-4-[(1R)-1-hydroxyethyl]-3-methylidene-5-propan-2-yloxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](C(C)C)[C@@H]1[C@@H](C)O |
| InChI | InChI=1S/C10H16O3/c1-5(2)9-8(7(4)11)6(3)10(12)13-9/h5,7-9,11H,3H2,1-2,4H3/t7-,8+,9+/m1/s1 |
| InChIKey | GMKNMKVIJBBOIQ-VGMNWLOBSA-N |
| XLogP | 1.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|