C23H40O4 — CID 158431570
3-methylidene-4,5-di(propan-2-yl)oxolan-2-one;6-methyl-3-methylidene-4-propan-2-ylhept-1-ene-2,5-diol (PubChem CID 158431570) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 3-methylidene-4,5-di(propan-2-yl)oxolan-2-one;6-methyl-3-methylidene-4-propan-2-ylhept-1-ene-2,5-diol.
| Compound Name | 3-methylidene-4,5-di(propan-2-yl)oxolan-2-one;6-methyl-3-methylidene-4-propan-2-ylhept-1-ene-2,5-diol |
|---|---|
| PubChem CID | 158431570 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 3-methylidene-4,5-di(propan-2-yl)oxolan-2-one;6-methyl-3-methylidene-4-propan-2-ylhept-1-ene-2,5-diol |
| SMILES | C=C(O)C(=C)C(C(C)C)C(O)C(C)C.C=C1C(=O)OC(C(C)C)C1C(C)C |
| InChI | InChI=1S/C12H22O2.C11H18O2/c1-7(2)11(9(5)10(6)13)12(14)8(3)4;1-6(2)9-8(5)11(12)13-10(9)7(3)4/h7-8,11-14H,5-6H2,1-4H3;6-7,9-10H,5H2,1-4H3 |
| InChIKey | HBSIOSLCCSEGAV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|