C14H14O2 — CID 23258424
1-(9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-dien-4-yl)ethanone (PubChem CID 23258424) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-dien-4-yl)ethanone.
| Compound Name | 1-(9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-dien-4-yl)ethanone |
|---|---|
| PubChem CID | 23258424 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-(9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-dien-4-yl)ethanone |
| SMILES | C=C1C(=C)C2OC1C1=C2CC(C(C)=O)=CC1 |
| InChI | InChI=1S/C14H14O2/c1-7-8(2)14-12-6-10(9(3)15)4-5-11(12)13(7)16-14/h4,13-14H,1-2,5-6H2,3H3 |
| InChIKey | WNNMSAJMIFUXKB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|