C24H26N2O4 — CID 23259378
6-O-benzyl 3-O-ethyl (1R,2S,4R,5S,7R)-2,4-dimethyl-7-phenyl-3,6-diazatricyclo[3.2.0.02,4]heptane-3,6-dicarboxylate (PubChem CID 23259378) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 6-O-benzyl 3-O-ethyl (1R,2S,4R,5S,7R)-2,4-dimethyl-7-phenyl-3,6-diazatricyclo[3.2.0.02,4]heptane-3,6-dicarboxylate.
| Compound Name | 6-O-benzyl 3-O-ethyl (1R,2S,4R,5S,7R)-2,4-dimethyl-7-phenyl-3,6-diazatricyclo[3.2.0.02,4]heptane-3,6-dicarboxylate |
|---|---|
| PubChem CID | 23259378 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 6-O-benzyl 3-O-ethyl (1R,2S,4R,5S,7R)-2,4-dimethyl-7-phenyl-3,6-diazatricyclo[3.2.0.02,4]heptane-3,6-dicarboxylate |
| SMILES | CCOC(=O)N1[C@]2(C)[C@@H]3[C@@H]([C@H](c4ccccc4)N3C(=O)OCc3ccccc3)[C@]12C |
| InChI | InChI=1S/C24H26N2O4/c1-4-29-22(28)26-23(2)18-19(17-13-9-6-10-14-17)25(20(18)24(23,26)3)21(27)30-15-16-11-7-5-8-12-16/h5-14,18-20H,4,15H2,1-3H3/t18-,19+,20+,23+,24-,26?/m1/s1 |
| InChIKey | SZQMBAZSJPATTH-VGIYHDTRSA-N |
| XLogP | 4.37 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|