C14H22O6S2 — CID 23259853
[(2R,3S)-1,1-dimethoxy-3-(4-methylphenyl)sulfinylbutan-2-yl] methanesulfonate (PubChem CID 23259853) has the molecular formula C14H22O6S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(2R,3S)-1,1-dimethoxy-3-(4-methylphenyl)sulfinylbutan-2-yl] methanesulfonate.
| Compound Name | [(2R,3S)-1,1-dimethoxy-3-(4-methylphenyl)sulfinylbutan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 23259853 |
| Molecular Formula | C14H22O6S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(2R,3S)-1,1-dimethoxy-3-(4-methylphenyl)sulfinylbutan-2-yl] methanesulfonate |
| SMILES | COC(OC)[C@@H](OS(C)(=O)=O)[C@H](C)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H22O6S2/c1-10-6-8-12(9-7-10)21(15)11(2)13(14(18-3)19-4)20-22(5,16)17/h6-9,11,13-14H,1-5H3/t11-,13-,21?/m0/s1 |
| InChIKey | VCCBMOHFEOIUIE-SCCSQDKUSA-N |
| XLogP | 1.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|