C15H22O7 — CID 23260390
(2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2H-furan-5-one (PubChem CID 23260390) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 23260390 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2H-furan-5-one |
| SMILES | COC1=C[C@H]([C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)OC1=O |
| InChI | InChI=1S/C15H22O7/c1-14(2)18-7-10(20-14)12-11(21-15(3,4)22-12)8-6-9(17-5)13(16)19-8/h6,8,10-12H,7H2,1-5H3/t8-,10-,11-,12-/m1/s1 |
| InChIKey | VJOPFADEYACCAR-HJQYOEGKSA-N |
| XLogP | 1.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |