C14H26N2O — CID 23265279
(1Z)-N,N-diethyl-4-methyl-1-morpholin-4-ylpenta-1,3-dien-1-amine (PubChem CID 23265279) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is (1Z)-N,N-diethyl-4-methyl-1-morpholin-4-ylpenta-1,3-dien-1-amine.
| Compound Name | (1Z)-N,N-diethyl-4-methyl-1-morpholin-4-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 23265279 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (1Z)-N,N-diethyl-4-methyl-1-morpholin-4-ylpenta-1,3-dien-1-amine |
| SMILES | CCN(CC)/C(=C/C=C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C14H26N2O/c1-5-15(6-2)14(8-7-13(3)4)16-9-11-17-12-10-16/h7-8H,5-6,9-12H2,1-4H3/b14-8- |
| InChIKey | BNVKGKOMCIEQNK-ZSOIEALJSA-N |
| XLogP | 2.47 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|