C16H32OSi — CID 23265976
2-butoxyethyl-dimethyl-[(2E,6E)-octa-2,6-dienyl]silane (PubChem CID 23265976) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is 2-butoxyethyl-dimethyl-[(2E,6E)-octa-2,6-dienyl]silane.
| Compound Name | 2-butoxyethyl-dimethyl-[(2E,6E)-octa-2,6-dienyl]silane |
|---|---|
| PubChem CID | 23265976 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2-butoxyethyl-dimethyl-[(2E,6E)-octa-2,6-dienyl]silane |
| SMILES | C/C=C/CC/C=C/C[Si](C)(C)CCOCCCC |
| InChI | InChI=1S/C16H32OSi/c1-5-7-9-10-11-12-15-18(3,4)16-14-17-13-8-6-2/h5,7,11-12H,6,8-10,13-16H2,1-4H3/b7-5+,12-11+ |
| InChIKey | RRGFDLAYPBKLBO-MCZQWLMRSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|