C12H11F3 — CID 23268260
2-but-2-ynyl-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 23268260) has the molecular formula C12H11F3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-but-2-ynyl-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-but-2-ynyl-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 23268260 |
| Molecular Formula | C12H11F3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-but-2-ynyl-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC#CCC1=C(C(F)(F)F)C2C=CC1C2 |
| InChI | InChI=1S/C12H11F3/c1-2-3-4-10-8-5-6-9(7-8)11(10)12(13,14)15/h5-6,8-9H,4,7H2,1H3 |
| InChIKey | DAVNOWMBVKPVIB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|