C17H15NO2 — CID 23270956
1-[(4R,5R)-3,4-diphenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone (PubChem CID 23270956) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-[(4R,5R)-3,4-diphenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone.
| Compound Name | 1-[(4R,5R)-3,4-diphenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 23270956 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-[(4R,5R)-3,4-diphenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone |
| SMILES | CC(=O)[C@@H]1ON=C(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c1-12(19)17-15(13-8-4-2-5-9-13)16(18-20-17)14-10-6-3-7-11-14/h2-11,15,17H,1H3/t15-,17+/m1/s1 |
| InChIKey | ZDFGIOJGYSJVDO-WBVHZDCISA-N |
| XLogP | 3.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |