C8H13N5O3S — CID 23274652
N-(3-methylsulfanylpropyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 23274652) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(3-methylsulfanylpropyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 23274652 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | CSCCCNC(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H13N5O3S/c1-17-4-2-3-9-7(14)5-12-6-10-8(11-12)13(15)16/h6H,2-5H2,1H3,(H,9,14) |
| InChIKey | DXLYQLZVHGODDU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|