C14H24N5PS — CID 2328293
N-bis(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl-N-methylmethanamine (PubChem CID 2328293) has the molecular formula C14H24N5PS and a molecular weight of 325.42 g/mol. Its IUPAC name is N-bis(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl-N-methylmethanamine.
| Compound Name | N-bis(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl-N-methylmethanamine |
|---|---|
| PubChem CID | 2328293 |
| Molecular Formula | C14H24N5PS |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-bis(1,3,5-trimethylpyrazol-4-yl)phosphinothioyl-N-methylmethanamine |
| SMILES | Cc1nn(C)c(C)c1P(=S)(c1c(C)nn(C)c1C)N(C)C |
| InChI | InChI=1S/C14H24N5PS/c1-9-13(11(3)18(7)15-9)20(21,17(5)6)14-10(2)16-19(8)12(14)4/h1-8H3 |
| InChIKey | WTIQUMUMMUSAGQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|