C12H18N6 — CID 2805548
bis(1,3,5-trimethylpyrazol-4-yl)diazene (PubChem CID 2805548) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is bis(1,3,5-trimethylpyrazol-4-yl)diazene.
| Compound Name | bis(1,3,5-trimethylpyrazol-4-yl)diazene |
|---|---|
| PubChem CID | 2805548 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | bis(1,3,5-trimethylpyrazol-4-yl)diazene |
| SMILES | Cc1nn(C)c(C)c1/N=N/c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H18N6/c1-7-11(9(3)17(5)15-7)13-14-12-8(2)16-18(6)10(12)4/h1-6H3/b14-13+ |
| InChIKey | KTLZHPQQCOAZIJ-BUHFOSPRSA-N |
| XLogP | 2.80 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|