C11H16N6 — CID 615958
(3,5-dimethyl-1H-pyrazol-4-yl)-(1,3,5-trimethylpyrazol-4-yl)diazene (PubChem CID 615958) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is (3,5-dimethyl-1H-pyrazol-4-yl)-(1,3,5-trimethylpyrazol-4-yl)diazene.
| Compound Name | (3,5-dimethyl-1H-pyrazol-4-yl)-(1,3,5-trimethylpyrazol-4-yl)diazene |
|---|---|
| PubChem CID | 615958 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (3,5-dimethyl-1H-pyrazol-4-yl)-(1,3,5-trimethylpyrazol-4-yl)diazene |
| SMILES | Cc1n[nH]c(C)c1/N=N/c1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H16N6/c1-6-10(7(2)13-12-6)14-15-11-8(3)16-17(5)9(11)4/h1-5H3,(H,12,13)/b15-14+ |
| InChIKey | HWAVZURVOKAHLR-CCEZHUSRSA-N |
| XLogP | 2.79 |
| TPSA | 71.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|