C13H16ClNO2 — CID 23291065
7-(1-chloropropoxy)-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 23291065) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 7-(1-chloropropoxy)-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 7-(1-chloropropoxy)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 23291065 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 7-(1-chloropropoxy)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | CCC(Cl)Oc1ccc2c(c1)CCCNC2=O |
| InChI | InChI=1S/C13H16ClNO2/c1-2-12(14)17-10-5-6-11-9(8-10)4-3-7-15-13(11)16/h5-6,8,12H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | YOIGIGNEPYTMCK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|