C20H38N2O2 — CID 23292854
N-[3,3-ditert-butyl-5-(propanoylamino)cyclohexyl]propanamide (PubChem CID 23292854) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is N-[3,3-ditert-butyl-5-(propanoylamino)cyclohexyl]propanamide.
| Compound Name | N-[3,3-ditert-butyl-5-(propanoylamino)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 23292854 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | N-[3,3-ditert-butyl-5-(propanoylamino)cyclohexyl]propanamide |
| SMILES | CCC(=O)NC1CC(NC(=O)CC)CC(C(C)(C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C20H38N2O2/c1-9-16(23)21-14-11-15(22-17(24)10-2)13-20(12-14,18(3,4)5)19(6,7)8/h14-15H,9-13H2,1-8H3,(H,21,23)(H,22,24) |
| InChIKey | UISFYQOOSIVUMJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |