C19H21N3O — CID 2330532
(2R,4E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanenitrile (PubChem CID 2330532) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (2R,4E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanenitrile.
| Compound Name | (2R,4E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanenitrile |
|---|---|
| PubChem CID | 2330532 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2R,4E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanenitrile |
| SMILES | CN1/C(=C/C(=O)[C@@H](C#N)C2=NCCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H21N3O/c1-19(2)14-7-4-5-9-16(14)22(3)18(19)11-17(23)13(12-20)15-8-6-10-21-15/h4-5,7,9,11,13H,6,8,10H2,1-3H3/b18-11+/t13-/m0/s1 |
| InChIKey | VXOOCMMAYUEOLM-FHXOWUIVSA-N |
| XLogP | 3.24 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|