C18H29NS — CID 23308531
(3S,6S)-N-cyclohexyltricyclo[4.3.1.13,8]undecane-1-carbothioamide (PubChem CID 23308531) has the molecular formula C18H29NS and a molecular weight of 291.50 g/mol. Its IUPAC name is (3S,6S)-N-cyclohexyltricyclo[4.3.1.13,8]undecane-1-carbothioamide.
| Compound Name | (3S,6S)-N-cyclohexyltricyclo[4.3.1.13,8]undecane-1-carbothioamide |
|---|---|
| PubChem CID | 23308531 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (3S,6S)-N-cyclohexyltricyclo[4.3.1.13,8]undecane-1-carbothioamide |
| SMILES | S=C(NC1CCCCC1)C12CC3C[C@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C18H29NS/c20-17(19-16-4-2-1-3-5-16)18-10-13-6-7-14(11-18)9-15(8-13)12-18/h13-16H,1-12H2,(H,19,20)/t13-,14-,15?,18?/m0/s1 |
| InChIKey | JQSUTUNRDAWLFO-KZGGZSBBSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|