C16H19NO6S — CID 23313834
1-(3-acetylsulfanylpropanoyl)-5,6-dimethoxy-2,3-dihydroindole-2-carboxylic acid (PubChem CID 23313834) has the molecular formula C16H19NO6S and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-(3-acetylsulfanylpropanoyl)-5,6-dimethoxy-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-(3-acetylsulfanylpropanoyl)-5,6-dimethoxy-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 23313834 |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-(3-acetylsulfanylpropanoyl)-5,6-dimethoxy-2,3-dihydroindole-2-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)N(C(=O)CCSC(C)=O)C(C(=O)O)C2 |
| InChI | InChI=1S/C16H19NO6S/c1-9(18)24-5-4-15(19)17-11-8-14(23-3)13(22-2)7-10(11)6-12(17)16(20)21/h7-8,12H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | BFCKVBUHPIRBPH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|