C12H19NO4S3 — CID 54394061
(2S)-1-(3-acetylsulfanylpropanoyl)-4,4-bis(methylsulfanyl)pyrrolidine-2-carboxylic acid (PubChem CID 54394061) has the molecular formula C12H19NO4S3 and a molecular weight of 337.49 g/mol. Its IUPAC name is (2S)-1-(3-acetylsulfanylpropanoyl)-4,4-bis(methylsulfanyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3-acetylsulfanylpropanoyl)-4,4-bis(methylsulfanyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54394061 |
| Molecular Formula | C12H19NO4S3 |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (2S)-1-(3-acetylsulfanylpropanoyl)-4,4-bis(methylsulfanyl)pyrrolidine-2-carboxylic acid |
| SMILES | CSC1(SC)C[C@@H](C(=O)O)N(C(=O)CCSC(C)=O)C1 |
| InChI | InChI=1S/C12H19NO4S3/c1-8(14)20-5-4-10(15)13-7-12(18-2,19-3)6-9(13)11(16)17/h9H,4-7H2,1-3H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | VIRMMGXVXMHFJJ-VIFPVBQESA-N |
| XLogP | 1.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|