C18H25Br2N3 — CID 23315182
4-[2-[4-(aminomethyl)phenyl]ethyl]-N,N'-dimethylbenzenecarboximidamide;dihydrobromide (PubChem CID 23315182) has the molecular formula C18H25Br2N3 and a molecular weight of 443.23 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)phenyl]ethyl]-N,N'-dimethylbenzenecarboximidamide;dihydrobromide.
| Compound Name | 4-[2-[4-(aminomethyl)phenyl]ethyl]-N,N'-dimethylbenzenecarboximidamide;dihydrobromide |
|---|---|
| PubChem CID | 23315182 |
| Molecular Formula | C18H25Br2N3 |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 4-[2-[4-(aminomethyl)phenyl]ethyl]-N,N'-dimethylbenzenecarboximidamide;dihydrobromide |
| SMILES | Br.Br.C/N=C(\NC)c1ccc(CCc2ccc(CN)cc2)cc1 |
| InChI | InChI=1S/C18H23N3.2BrH/c1-20-18(21-2)17-11-9-15(10-12-17)4-3-14-5-7-16(13-19)8-6-14;;/h5-12H,3-4,13,19H2,1-2H3,(H,20,21);2*1H |
| InChIKey | NKLVPXZCXIZKBE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|