C18H16N2O5S — CID 23318276
4-[2-(1,3-benzothiazol-2-ylmethoxy)-N-hydroxyanilino]-4-oxobutanoic acid (PubChem CID 23318276) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-[2-(1,3-benzothiazol-2-ylmethoxy)-N-hydroxyanilino]-4-oxobutanoic acid.
| Compound Name | 4-[2-(1,3-benzothiazol-2-ylmethoxy)-N-hydroxyanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 23318276 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 4-[2-(1,3-benzothiazol-2-ylmethoxy)-N-hydroxyanilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(O)c1ccccc1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H16N2O5S/c21-17(9-10-18(22)23)20(24)13-6-2-3-7-14(13)25-11-16-19-12-5-1-4-8-15(12)26-16/h1-8,24H,9-11H2,(H,22,23) |
| InChIKey | MYKCCYKFYVZCPS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|