C13H18IN3 — CID 23324018
4-(3-iodoindazol-1-yl)-N,N-dimethylbutan-2-amine (PubChem CID 23324018) has the molecular formula C13H18IN3 and a molecular weight of 343.21 g/mol. Its IUPAC name is 4-(3-iodoindazol-1-yl)-N,N-dimethylbutan-2-amine.
| Compound Name | 4-(3-iodoindazol-1-yl)-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 23324018 |
| Molecular Formula | C13H18IN3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-(3-iodoindazol-1-yl)-N,N-dimethylbutan-2-amine |
| SMILES | CC(CCn1nc(I)c2ccccc21)N(C)C |
| InChI | InChI=1S/C13H18IN3/c1-10(16(2)3)8-9-17-12-7-5-4-6-11(12)13(14)15-17/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | WZFMFNHXIODSPQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|