About 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid
2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid (PubChem CID 23334104) has the molecular formula C10H10N2O7S2
and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid.
Molecular Properties
| Compound Name | 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid |
| PubChem CID | 23334104 |
| Molecular Formula | C10H10N2O7S2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid |
| SMILES | CC1=NN(c2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)CC1=O |
| InChI | InChI=1S/C10H10N2O7S2/c1-6-9(13)5-12(11-6)8-4-7(20(14,15)16)2-3-10(8)21(17,18)19/h2-4H,5H2,1H3,(H,14,15,16)(H,17,18,19) |
| InChIKey | AVLLMZBYEVONDX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid?
The IUPAC name of 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid (CID 23334104) is 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid.
What is the SMILES notation for 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid?
The canonical SMILES for 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid is CC1=NN(c2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)CC1=O.
What is the InChIKey of 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid?
The InChIKey is AVLLMZBYEVONDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O7S2/c1-6-9(13)5-12(11-6)8-4-7(20(14,15)16)2-3-10(8)21(17,18)19/h2-4H,5H2,1H3,(H,14,15,16)(H,17,18,19).
What are the key properties of 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid?
2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid has a molecular weight of 334.33 g/mol, XLogP of -0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-4-oxo-3H-pyrazol-2-yl)benzene-1,4-disulfonic acid is sourced from PubChem (CID 23334104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).