C10H13NOS — CID 23336593
7-methylsulfinyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 23336593) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 7-methylsulfinyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-methylsulfinyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 23336593 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 7-methylsulfinyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CS(=O)c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C10H13NOS/c1-13(12)10-3-2-8-4-5-11-7-9(8)6-10/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | YTJMLRLGNNOLSD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |